C15H17FN4O3S — CID 100819637
[1-(4-fluorophenyl)imidazol-4-yl]-(4-methylsulfonylpiperazin-1-yl)methanone (PubChem CID 100819637) has the molecular formula C15H17FN4O3S and a molecular weight of 352.39 g/mol. Its IUPAC name is [1-(4-fluorophenyl)imidazol-4-yl]-(4-methylsulfonylpiperazin-1-yl)methanone.
| Compound Name | [1-(4-fluorophenyl)imidazol-4-yl]-(4-methylsulfonylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 100819637 |
| Molecular Formula | C15H17FN4O3S |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.10 |
| IUPAC Name | [1-(4-fluorophenyl)imidazol-4-yl]-(4-methylsulfonylpiperazin-1-yl)methanone |
| SMILES | CS(=O)(=O)N1CCN(C(=O)c2cn(-c3ccc(F)cc3)cn2)CC1 |
| InChI | InChI=1S/C15H17FN4O3S/c1-24(22,23)20-8-6-18(7-9-20)15(21)14-10-19(11-17-14)13-4-2-12(16)3-5-13/h2-5,10-11H,6-9H2,1H3 |
| InChIKey | RMEZSNYNYRHGOP-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 75.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |