C14H20S2 — CID 10083586
(3aR)-3a-methyl-3-methylidenespiro[1,2,4,5-tetrahydroindene-6,2'-1,3-dithiane] (PubChem CID 10083586) has the molecular formula C14H20S2 and a molecular weight of 252.45 g/mol. Its IUPAC name is (3aR)-3a-methyl-3-methylidenespiro[1,2,4,5-tetrahydroindene-6,2'-1,3-dithiane].
| Compound Name | (3aR)-3a-methyl-3-methylidenespiro[1,2,4,5-tetrahydroindene-6,2'-1,3-dithiane] |
|---|---|
| PubChem CID | 10083586 |
| Molecular Formula | C14H20S2 |
| Molecular Weight | 252.45 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | (3aR)-3a-methyl-3-methylidenespiro[1,2,4,5-tetrahydroindene-6,2'-1,3-dithiane] |
| SMILES | C=C1CCC2=CC3(CC[C@]12C)SCCCS3 |
| InChI | InChI=1S/C14H20S2/c1-11-4-5-12-10-14(7-6-13(11,12)2)15-8-3-9-16-14/h10H,1,3-9H2,2H3/t13-/m1/s1 |
| InChIKey | FINMQLIDQQQBFE-CYBMUJFWSA-N |
| XLogP | 4.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.45 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|