C11H18S2 — CID 164673387
2-[[(1R)-1-methylcyclopent-2-en-1-yl]methyl]-1,3-dithiane (PubChem CID 164673387) has the molecular formula C11H18S2 and a molecular weight of 214.40 g/mol. Its IUPAC name is 2-[[(1R)-1-methylcyclopent-2-en-1-yl]methyl]-1,3-dithiane.
| Compound Name | 2-[[(1R)-1-methylcyclopent-2-en-1-yl]methyl]-1,3-dithiane |
|---|---|
| PubChem CID | 164673387 |
| Molecular Formula | C11H18S2 |
| Molecular Weight | 214.40 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 2-[[(1R)-1-methylcyclopent-2-en-1-yl]methyl]-1,3-dithiane |
| SMILES | C[C@@]1(CC2SCCCS2)C=CCC1 |
| InChI | InChI=1S/C11H18S2/c1-11(5-2-3-6-11)9-10-12-7-4-8-13-10/h2,5,10H,3-4,6-9H2,1H3/t11-/m1/s1 |
| InChIKey | SYXQLLBIQZMPJP-LLVKDONJSA-N |
| XLogP | 3.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.40 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|