C16H18O3 — CID 10083852
(7-hydroxy-6,6-dimethyl-4,5,8,9-tetradehydro-1,2,7,10-tetrahydrocyclopenta[9]annulen-10a-yl) acetate (PubChem CID 10083852) has the molecular formula C16H18O3 and a molecular weight of 258.32 g/mol. Its IUPAC name is (7-hydroxy-6,6-dimethyl-4,5,8,9-tetradehydro-1,2,7,10-tetrahydrocyclopenta[9]annulen-10a-yl) acetate.
| Compound Name | (7-hydroxy-6,6-dimethyl-4,5,8,9-tetradehydro-1,2,7,10-tetrahydrocyclopenta[9]annulen-10a-yl) acetate |
|---|---|
| PubChem CID | 10083852 |
| Molecular Formula | C16H18O3 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | (7-hydroxy-6,6-dimethyl-4,5,8,9-tetradehydro-1,2,7,10-tetrahydrocyclopenta[9]annulen-10a-yl) acetate |
| SMILES | CC(=O)OC12CC#CC(O)C(C)(C)C#CC1=CCC2 |
| InChI | InChI=1S/C16H18O3/c1-12(17)19-16-9-4-6-13(16)8-11-15(2,3)14(18)7-5-10-16/h6,14,18H,4,9-10H2,1-3H3 |
| InChIKey | AQOXWHZYIUDPHK-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|