C22H32N4O4S — CID 100880751
(2R)-2-[(4aS,8aR)-1-cyclopropyl-2-oxo-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-6-yl]-N-[2-(4-sulfamoylphenyl)ethyl]propanamide (PubChem CID 100880751) has the molecular formula C22H32N4O4S and a molecular weight of 448.59 g/mol. Its IUPAC name is (2R)-2-[(4aS,8aR)-1-cyclopropyl-2-oxo-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-6-yl]-N-[2-(4-sulfamoylphenyl)ethyl]propanamide.
| Compound Name | (2R)-2-[(4aS,8aR)-1-cyclopropyl-2-oxo-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-6-yl]-N-[2-(4-sulfamoylphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 100880751 |
| Molecular Formula | C22H32N4O4S |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | (2R)-2-[(4aS,8aR)-1-cyclopropyl-2-oxo-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-6-yl]-N-[2-(4-sulfamoylphenyl)ethyl]propanamide |
| SMILES | C[C@H](C(=O)NCCc1ccc(S(N)(=O)=O)cc1)N1CC[C@@H]2[C@@H](CCC(=O)N2C2CC2)C1 |
| InChI | InChI=1S/C22H32N4O4S/c1-15(22(28)24-12-10-16-2-7-19(8-3-16)31(23,29)30)25-13-11-20-17(14-25)4-9-21(27)26(20)18-5-6-18/h2-3,7-8,15,17-18,20H,4-6,9-14H2,1H3,(H,24,28)(H2,23,29,30)/t15-,17+,20-/m1/s1 |
| InChIKey | DXZXBEFWPCTDPG-OXFYSEKESA-N |
| XLogP | 0.86 |
| TPSA | 112.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |