C26H29NO2 — CID 10091632
(2S,3S)-2-[(1S)-1-(dibenzylamino)-2-phenylethyl]oxolan-3-ol (PubChem CID 10091632) has the molecular formula C26H29NO2 and a molecular weight of 387.52 g/mol. Its IUPAC name is (2S,3S)-2-[(1S)-1-(dibenzylamino)-2-phenylethyl]oxolan-3-ol.
| Compound Name | (2S,3S)-2-[(1S)-1-(dibenzylamino)-2-phenylethyl]oxolan-3-ol |
|---|---|
| PubChem CID | 10091632 |
| Molecular Formula | C26H29NO2 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | (2S,3S)-2-[(1S)-1-(dibenzylamino)-2-phenylethyl]oxolan-3-ol |
| SMILES | O[C@H]1CCO[C@H]1[C@H](Cc1ccccc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C26H29NO2/c28-25-16-17-29-26(25)24(18-21-10-4-1-5-11-21)27(19-22-12-6-2-7-13-22)20-23-14-8-3-9-15-23/h1-15,24-26,28H,16-20H2/t24-,25-,26-/m0/s1 |
| InChIKey | FKNTWZQQFZUUAR-GSDHBNRESA-N |
| XLogP | 4.45 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |