C24H16I4O6 — CID 100919714
tert-butyl 2-(3-hydroxy-2,4,5,7-tetraiodo-6-oxoxanthen-9-yl)benzenecarboperoxoate (PubChem CID 100919714) has the molecular formula C24H16I4O6 and a molecular weight of 908.00 g/mol. Its IUPAC name is tert-butyl 2-(3-hydroxy-2,4,5,7-tetraiodo-6-oxoxanthen-9-yl)benzenecarboperoxoate.
| Compound Name | tert-butyl 2-(3-hydroxy-2,4,5,7-tetraiodo-6-oxoxanthen-9-yl)benzenecarboperoxoate |
|---|---|
| PubChem CID | 100919714 |
| Molecular Formula | C24H16I4O6 |
| Molecular Weight | 908.00 g/mol |
| Exact Mass | 907.71 |
| IUPAC Name | tert-butyl 2-(3-hydroxy-2,4,5,7-tetraiodo-6-oxoxanthen-9-yl)benzenecarboperoxoate |
| SMILES | CC(C)(C)OOC(=O)c1ccccc1-c1c2cc(I)c(=O)c(I)c-2oc2c(I)c(O)c(I)cc12 |
| InChI | InChI=1S/C24H16I4O6/c1-24(2,3)34-33-23(31)11-7-5-4-6-10(11)16-12-8-14(25)19(29)17(27)21(12)32-22-13(16)9-15(26)20(30)18(22)28/h4-9,29H,1-3H3 |
| InChIKey | RMSHHKIHNPRQOZ-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 908.00 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|