C23H13I2NO7S — CID 20549122
2-(3-hydroxy-2,7-diiodo-4,5-dimethoxy-6-oxoxanthen-9-yl)-5-isothiocyanatobenzoic acid (PubChem CID 20549122) has the molecular formula C23H13I2NO7S and a molecular weight of 701.23 g/mol. Its IUPAC name is 2-(3-hydroxy-2,7-diiodo-4,5-dimethoxy-6-oxoxanthen-9-yl)-5-isothiocyanatobenzoic acid.
| Compound Name | 2-(3-hydroxy-2,7-diiodo-4,5-dimethoxy-6-oxoxanthen-9-yl)-5-isothiocyanatobenzoic acid |
|---|---|
| PubChem CID | 20549122 |
| Molecular Formula | C23H13I2NO7S |
| Molecular Weight | 701.23 g/mol |
| Exact Mass | 700.85 |
| IUPAC Name | 2-(3-hydroxy-2,7-diiodo-4,5-dimethoxy-6-oxoxanthen-9-yl)-5-isothiocyanatobenzoic acid |
| SMILES | COc1c2oc3c(OC)c(O)c(I)cc3c(-c3ccc(N=C=S)cc3C(=O)O)c-2cc(I)c1=O |
| InChI | InChI=1S/C23H13I2NO7S/c1-31-21-17(27)14(24)6-12-16(10-4-3-9(26-8-34)5-11(10)23(29)30)13-7-15(25)18(28)22(32-2)20(13)33-19(12)21/h3-7,27H,1-2H3,(H,29,30) |
| InChIKey | KPSXVLXVAXVVKF-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 118.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.23 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|