C23H16Cl2O7 — CID 144555537
2-(4,5-dichloro-3-hydroxy-2,7-dimethoxy-6-oxoxanthen-9-yl)-4-methylbenzoic acid (PubChem CID 144555537) has the molecular formula C23H16Cl2O7 and a molecular weight of 475.28 g/mol. Its IUPAC name is 2-(4,5-dichloro-3-hydroxy-2,7-dimethoxy-6-oxoxanthen-9-yl)-4-methylbenzoic acid.
| Compound Name | 2-(4,5-dichloro-3-hydroxy-2,7-dimethoxy-6-oxoxanthen-9-yl)-4-methylbenzoic acid |
|---|---|
| PubChem CID | 144555537 |
| Molecular Formula | C23H16Cl2O7 |
| Molecular Weight | 475.28 g/mol |
| Exact Mass | 474.03 |
| IUPAC Name | 2-(4,5-dichloro-3-hydroxy-2,7-dimethoxy-6-oxoxanthen-9-yl)-4-methylbenzoic acid |
| SMILES | COc1cc2c(-c3cc(C)ccc3C(=O)O)c3cc(OC)c(=O)c(Cl)c-3oc2c(Cl)c1O |
| InChI | InChI=1S/C23H16Cl2O7/c1-9-4-5-10(23(28)29)11(6-9)16-12-7-14(30-2)19(26)17(24)21(12)32-22-13(16)8-15(31-3)20(27)18(22)25/h4-8,26H,1-3H3,(H,28,29) |
| InChIKey | SILVJRUWQGGKLA-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.28 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|