C21H8Cl6O4 — CID 89417728
3,6-dichloro-2-(2,4,5,7-tetrachloro-3-methyl-6-oxoxanthen-9-yl)benzoic acid (PubChem CID 89417728) has the molecular formula C21H8Cl6O4 and a molecular weight of 537.01 g/mol. Its IUPAC name is 3,6-dichloro-2-(2,4,5,7-tetrachloro-3-methyl-6-oxoxanthen-9-yl)benzoic acid.
| Compound Name | 3,6-dichloro-2-(2,4,5,7-tetrachloro-3-methyl-6-oxoxanthen-9-yl)benzoic acid |
|---|---|
| PubChem CID | 89417728 |
| Molecular Formula | C21H8Cl6O4 |
| Molecular Weight | 537.01 g/mol |
| Exact Mass | 533.86 |
| IUPAC Name | 3,6-dichloro-2-(2,4,5,7-tetrachloro-3-methyl-6-oxoxanthen-9-yl)benzoic acid |
| SMILES | Cc1c(Cl)cc2c(-c3c(Cl)ccc(Cl)c3C(=O)O)c3cc(Cl)c(=O)c(Cl)c-3oc2c1Cl |
| InChI | InChI=1S/C21H8Cl6O4/c1-6-11(24)4-7-13(14-9(22)2-3-10(23)15(14)21(29)30)8-5-12(25)18(28)17(27)20(8)31-19(7)16(6)26/h2-5H,1H3,(H,29,30) |
| InChIKey | MQTFUBVIBYMJBY-UHFFFAOYSA-N |
| XLogP | 8.49 |
| TPSA | 67.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.01 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|