C51H28Cl2N2O7 — CID 135433367
2,5-dichloro-3-(3-hydroxy-2,7-dinaphthalen-2-yl-6-oxo-4,5-dipyridin-2-ylxanthen-9-yl)terephthalic acid (PubChem CID 135433367) has the molecular formula C51H28Cl2N2O7 and a molecular weight of 851.70 g/mol. Its IUPAC name is 2,5-dichloro-3-(3-hydroxy-2,7-dinaphthalen-2-yl-6-oxo-4,5-dipyridin-2-ylxanthen-9-yl)terephthalic acid.
| Compound Name | 2,5-dichloro-3-(3-hydroxy-2,7-dinaphthalen-2-yl-6-oxo-4,5-dipyridin-2-ylxanthen-9-yl)terephthalic acid |
|---|---|
| PubChem CID | 135433367 |
| Molecular Formula | C51H28Cl2N2O7 |
| Molecular Weight | 851.70 g/mol |
| Exact Mass | 850.13 |
| IUPAC Name | 2,5-dichloro-3-(3-hydroxy-2,7-dinaphthalen-2-yl-6-oxo-4,5-dipyridin-2-ylxanthen-9-yl)terephthalic acid |
| SMILES | O=C(O)c1cc(Cl)c(C(=O)O)c(-c2c3cc(-c4ccc5ccccc5c4)c(=O)c(-c4ccccn4)c-3oc3c(-c4ccccn4)c(O)c(-c4ccc5ccccc5c4)cc23)c1Cl |
| InChI | InChI=1S/C51H28Cl2N2O7/c52-37-25-36(50(58)59)45(53)44(41(37)51(60)61)40-34-23-32(30-17-15-26-9-1-3-11-28(26)21-30)46(56)42(38-13-5-7-19-54-38)48(34)62-49-35(40)24-33(47(57)43(49)39-14-6-8-20-55-39)31-18-16-27-10-2-4-12-29(27)22-31/h1-25,56H,(H,58,59)(H,60,61) |
| InChIKey | GANRPNWBXBYBGM-UHFFFAOYSA-N |
| XLogP | 12.74 |
| TPSA | 150.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 851.70 |
| LogP ≤ 5 | 12.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|