C24H14Cl6O5 — CID 122674791
3,6-dichloro-4-(2-methylpropyl)-2-(2,4,5,7-tetrachloro-3-hydroxy-6-oxoxanthen-9-yl)benzoic acid (PubChem CID 122674791) has the molecular formula C24H14Cl6O5 and a molecular weight of 595.09 g/mol. Its IUPAC name is 3,6-dichloro-4-(2-methylpropyl)-2-(2,4,5,7-tetrachloro-3-hydroxy-6-oxoxanthen-9-yl)benzoic acid.
| Compound Name | 3,6-dichloro-4-(2-methylpropyl)-2-(2,4,5,7-tetrachloro-3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
|---|---|
| PubChem CID | 122674791 |
| Molecular Formula | C24H14Cl6O5 |
| Molecular Weight | 595.09 g/mol |
| Exact Mass | 591.90 |
| IUPAC Name | 3,6-dichloro-4-(2-methylpropyl)-2-(2,4,5,7-tetrachloro-3-hydroxy-6-oxoxanthen-9-yl)benzoic acid |
| SMILES | CC(C)Cc1cc(Cl)c(C(=O)O)c(-c2c3cc(Cl)c(=O)c(Cl)c-3oc3c(Cl)c(O)c(Cl)cc23)c1Cl |
| InChI | InChI=1S/C24H14Cl6O5/c1-7(2)3-8-4-11(25)15(24(33)34)16(17(8)28)14-9-5-12(26)20(31)18(29)22(9)35-23-10(14)6-13(27)21(32)19(23)30/h4-7,31H,3H2,1-2H3,(H,33,34) |
| InChIKey | FBOVDKDIRAWJDV-UHFFFAOYSA-N |
| XLogP | 9.09 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.09 |
| LogP ≤ 5 | 9.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|