C23H20Cl2O5 — CID 91094390
4,5-dichloro-6-hydroxy-2,7-dimethoxy-9-phenylxanthen-3-one;ethane (PubChem CID 91094390) has the molecular formula C23H20Cl2O5 and a molecular weight of 447.31 g/mol. Its IUPAC name is 4,5-dichloro-6-hydroxy-2,7-dimethoxy-9-phenylxanthen-3-one;ethane.
| Compound Name | 4,5-dichloro-6-hydroxy-2,7-dimethoxy-9-phenylxanthen-3-one;ethane |
|---|---|
| PubChem CID | 91094390 |
| Molecular Formula | C23H20Cl2O5 |
| Molecular Weight | 447.31 g/mol |
| Exact Mass | 446.07 |
| IUPAC Name | 4,5-dichloro-6-hydroxy-2,7-dimethoxy-9-phenylxanthen-3-one;ethane |
| SMILES | CC.COc1cc2c(-c3ccccc3)c3cc(OC)c(=O)c(Cl)c-3oc2c(Cl)c1O |
| InChI | InChI=1S/C21H14Cl2O5.C2H6/c1-26-13-8-11-15(10-6-4-3-5-7-10)12-9-14(27-2)19(25)17(23)21(12)28-20(11)16(22)18(13)24;1-2/h3-9,24H,1-2H3;1-2H3 |
| InChIKey | UWPBMPRCXTUOIA-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.31 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|