C19H7I4NaO3 — CID 166508188
sodium 2,4,5,7-tetraiodo-6-oxo-9-phenylxanthen-3-olate (PubChem CID 166508188) has the molecular formula C19H7I4NaO3 and a molecular weight of 813.87 g/mol. Its IUPAC name is sodium 2,4,5,7-tetraiodo-6-oxo-9-phenylxanthen-3-olate.
| Compound Name | sodium 2,4,5,7-tetraiodo-6-oxo-9-phenylxanthen-3-olate |
|---|---|
| PubChem CID | 166508188 |
| Molecular Formula | C19H7I4NaO3 |
| Molecular Weight | 813.87 g/mol |
| Exact Mass | 813.65 |
| IUPAC Name | sodium 2,4,5,7-tetraiodo-6-oxo-9-phenylxanthen-3-olate |
| SMILES | O=c1c(I)cc2c(-c3ccccc3)c3cc(I)c([O-])c(I)c3oc-2c1I.[Na+] |
| InChI | InChI=1S/C19H8I4O3.Na/c20-11-6-9-13(8-4-2-1-3-5-8)10-7-12(21)17(25)15(23)19(10)26-18(9)14(22)16(11)24;/h1-7,24H;/q;+1/p-1 |
| InChIKey | NADPPHRCOAEYOZ-UHFFFAOYSA-M |
| XLogP | 3.06 |
| TPSA | 53.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 813.87 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|