C26H20Cl2N4O8 — CID 138968218
5-(3-azidopropylcarbamoyl)-2-(4,5-dichloro-3-hydroxy-2,7-dimethoxy-6-oxoxanthen-9-yl)benzoic acid (PubChem CID 138968218) has the molecular formula C26H20Cl2N4O8 and a molecular weight of 587.37 g/mol. Its IUPAC name is 5-(3-azidopropylcarbamoyl)-2-(4,5-dichloro-3-hydroxy-2,7-dimethoxy-6-oxoxanthen-9-yl)benzoic acid.
| Compound Name | 5-(3-azidopropylcarbamoyl)-2-(4,5-dichloro-3-hydroxy-2,7-dimethoxy-6-oxoxanthen-9-yl)benzoic acid |
|---|---|
| PubChem CID | 138968218 |
| Molecular Formula | C26H20Cl2N4O8 |
| Molecular Weight | 587.37 g/mol |
| Exact Mass | 586.07 |
| IUPAC Name | 5-(3-azidopropylcarbamoyl)-2-(4,5-dichloro-3-hydroxy-2,7-dimethoxy-6-oxoxanthen-9-yl)benzoic acid |
| SMILES | COc1cc2c(-c3ccc(C(=O)NCCCN=[N+]=[N-])cc3C(=O)O)c3cc(OC)c(=O)c(Cl)c-3oc2c(Cl)c1O |
| InChI | InChI=1S/C26H20Cl2N4O8/c1-38-16-9-14-18(12-5-4-11(8-13(12)26(36)37)25(35)30-6-3-7-31-32-29)15-10-17(39-2)22(34)20(28)24(15)40-23(14)19(27)21(16)33/h4-5,8-10,33H,3,6-7H2,1-2H3,(H,30,35)(H,36,37) |
| InChIKey | PTWNZXALERVQQQ-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 184.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 587.37 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|