C30H29ClN4O3S2 — CID 118557036
[9-(2-carboxy-4-isothiocyanatophenyl)-6-(diethylamino)-4-isothiocyanatoxanthen-3-ylidene]-diethylazanium chloride (PubChem CID 118557036) has the molecular formula C30H29ClN4O3S2 and a molecular weight of 593.17 g/mol. Its IUPAC name is [9-(2-carboxy-4-isothiocyanatophenyl)-6-(diethylamino)-4-isothiocyanatoxanthen-3-ylidene]-diethylazanium chloride.
| Compound Name | [9-(2-carboxy-4-isothiocyanatophenyl)-6-(diethylamino)-4-isothiocyanatoxanthen-3-ylidene]-diethylazanium chloride |
|---|---|
| PubChem CID | 118557036 |
| Molecular Formula | C30H29ClN4O3S2 |
| Molecular Weight | 593.17 g/mol |
| Exact Mass | 592.14 |
| IUPAC Name | [9-(2-carboxy-4-isothiocyanatophenyl)-6-(diethylamino)-4-isothiocyanatoxanthen-3-ylidene]-diethylazanium chloride |
| SMILES | CCN(CC)c1ccc2c(-c3ccc(N=C=S)cc3C(=O)O)c3ccc(=[N+](CC)CC)c(N=C=S)c-3oc2c1.[Cl-] |
| InChI | InChI=1S/C30H28N4O3S2.ClH/c1-5-33(6-2)20-10-12-22-26(16-20)37-29-23(13-14-25(28(29)32-18-39)34(7-3)8-4)27(22)21-11-9-19(31-17-38)15-24(21)30(35)36;/h9-16H,5-8H2,1-4H3;1H |
| InChIKey | KVSXAMAHDYODJJ-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 81.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.17 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|