C31H34N3O3S+ — CID 91448474
[9-(2-carboxy-5-isothiocyanato-5-methylcyclohepta-1,3,6-trien-1-yl)-6-(diethylamino)xanthen-3-ylidene]-diethylazanium (PubChem CID 91448474) has the molecular formula C31H34N3O3S+ and a molecular weight of 528.70 g/mol. Its IUPAC name is [9-(2-carboxy-5-isothiocyanato-5-methylcyclohepta-1,3,6-trien-1-yl)-6-(diethylamino)xanthen-3-ylidene]-diethylazanium.
| Compound Name | [9-(2-carboxy-5-isothiocyanato-5-methylcyclohepta-1,3,6-trien-1-yl)-6-(diethylamino)xanthen-3-ylidene]-diethylazanium |
|---|---|
| PubChem CID | 91448474 |
| Molecular Formula | C31H34N3O3S+ |
| Molecular Weight | 528.70 g/mol |
| Exact Mass | 528.23 |
| IUPAC Name | [9-(2-carboxy-5-isothiocyanato-5-methylcyclohepta-1,3,6-trien-1-yl)-6-(diethylamino)xanthen-3-ylidene]-diethylazanium |
| SMILES | CCN(CC)c1ccc2c(C3=C(C(=O)O)C=CC(C)(N=C=S)C=C3)c3ccc(=[N+](CC)CC)cc-3oc2c1 |
| InChI | InChI=1S/C31H33N3O3S/c1-6-33(7-2)21-10-12-25-27(18-21)37-28-19-22(34(8-3)9-4)11-13-26(28)29(25)23-14-16-31(5,32-20-38)17-15-24(23)30(35)36/h10-19H,6-9H2,1-5H3/p+1 |
| InChIKey | OCTFIGLUHPCTAG-UHFFFAOYSA-O |
| XLogP | 6.02 |
| TPSA | 69.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.70 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|