C31H37N2O4+ — CID 156710718
[9-(2-carboxy-5,5-dimethylcyclohepta-1,3,6-trien-1-yl)-6-(dimethylamino)xanthen-3-ylidene]-dimethylazanium;2-methylpropanal (PubChem CID 156710718) has the molecular formula C31H37N2O4+ and a molecular weight of 501.65 g/mol. Its IUPAC name is [9-(2-carboxy-5,5-dimethylcyclohepta-1,3,6-trien-1-yl)-6-(dimethylamino)xanthen-3-ylidene]-dimethylazanium;2-methylpropanal.
| Compound Name | [9-(2-carboxy-5,5-dimethylcyclohepta-1,3,6-trien-1-yl)-6-(dimethylamino)xanthen-3-ylidene]-dimethylazanium;2-methylpropanal |
|---|---|
| PubChem CID | 156710718 |
| Molecular Formula | C31H37N2O4+ |
| Molecular Weight | 501.65 g/mol |
| Exact Mass | 501.27 |
| IUPAC Name | [9-(2-carboxy-5,5-dimethylcyclohepta-1,3,6-trien-1-yl)-6-(dimethylamino)xanthen-3-ylidene]-dimethylazanium;2-methylpropanal |
| SMILES | CC(C)C=O.CN(C)c1ccc2c(C3=C(C(=O)O)C=CC(C)(C)C=C3)c3ccc(=[N+](C)C)cc-3oc2c1 |
| InChI | InChI=1S/C27H28N2O3.C4H8O/c1-27(2)13-11-19(20(12-14-27)26(30)31)25-21-9-7-17(28(3)4)15-23(21)32-24-16-18(29(5)6)8-10-22(24)25;1-4(2)3-5/h7-16H,1-6H3;3-4H,1-2H3/p+1 |
| InChIKey | YKGBNFIKIDXZIU-UHFFFAOYSA-O |
| XLogP | 5.47 |
| TPSA | 73.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.65 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|