C19H19ClN4O4 — CID 100922863
3-[(3aR,4R,6R)-2,2-dimethyl-4-phenylmethoxy-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-6-chloro-[1,2,4]triazolo[4,3-b]pyridazine (PubChem CID 100922863) has the molecular formula C19H19ClN4O4 and a molecular weight of 402.84 g/mol. Its IUPAC name is 3-[(3aR,4R,6R)-2,2-dimethyl-4-phenylmethoxy-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-6-chloro-[1,2,4]triazolo[4,3-b]pyridazine.
| Compound Name | 3-[(3aR,4R,6R)-2,2-dimethyl-4-phenylmethoxy-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-6-chloro-[1,2,4]triazolo[4,3-b]pyridazine |
|---|---|
| PubChem CID | 100922863 |
| Molecular Formula | C19H19ClN4O4 |
| Molecular Weight | 402.84 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | 3-[(3aR,4R,6R)-2,2-dimethyl-4-phenylmethoxy-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]-6-chloro-[1,2,4]triazolo[4,3-b]pyridazine |
| SMILES | CC1(C)OC2[C@@H](c3nnc4ccc(Cl)nn34)O[C@@H](OCc3ccccc3)[C@@H]2O1 |
| InChI | InChI=1S/C19H19ClN4O4/c1-19(2)27-14-15(17-22-21-13-9-8-12(20)23-24(13)17)26-18(16(14)28-19)25-10-11-6-4-3-5-7-11/h3-9,14-16,18H,10H2,1-2H3/t14?,15-,16+,18+/m0/s1 |
| InChIKey | XTRSVXAJNPYMOP-KWZXVHAESA-N |
| XLogP | 2.91 |
| TPSA | 80.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.84 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |