C13H14O8S — CID 100925569
[(2R,3R,3aR,6S,6aS)-2,3-dihydroxy-5-oxo-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-6-yl] 4-methylbenzenesulfonate (PubChem CID 100925569) has the molecular formula C13H14O8S and a molecular weight of 330.31 g/mol. Its IUPAC name is [(2R,3R,3aR,6S,6aS)-2,3-dihydroxy-5-oxo-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-6-yl] 4-methylbenzenesulfonate.
| Compound Name | [(2R,3R,3aR,6S,6aS)-2,3-dihydroxy-5-oxo-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-6-yl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 100925569 |
| Molecular Formula | C13H14O8S |
| Molecular Weight | 330.31 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | [(2R,3R,3aR,6S,6aS)-2,3-dihydroxy-5-oxo-3,3a,6,6a-tetrahydro-2H-furo[3,2-b]furan-6-yl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@@H]2C(=O)O[C@@H]3[C@@H](O)[C@H](O)O[C@@H]32)cc1 |
| InChI | InChI=1S/C13H14O8S/c1-6-2-4-7(5-3-6)22(17,18)21-11-10-9(19-13(11)16)8(14)12(15)20-10/h2-5,8-12,14-15H,1H3/t8-,9-,10+,11+,12-/m1/s1 |
| InChIKey | MIPOYGCXLSOOON-LDMBFOFVSA-N |
| XLogP | -0.93 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.31 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|