C14H16O8S — CID 139190053
methyl (2S,3S,4S)-3-hydroxy-3-methyl-4-(4-methylphenyl)sulfonyloxy-5-oxooxolane-2-carboxylate (PubChem CID 139190053) has the molecular formula C14H16O8S and a molecular weight of 344.34 g/mol. Its IUPAC name is methyl (2S,3S,4S)-3-hydroxy-3-methyl-4-(4-methylphenyl)sulfonyloxy-5-oxooxolane-2-carboxylate.
| Compound Name | methyl (2S,3S,4S)-3-hydroxy-3-methyl-4-(4-methylphenyl)sulfonyloxy-5-oxooxolane-2-carboxylate |
|---|---|
| PubChem CID | 139190053 |
| Molecular Formula | C14H16O8S |
| Molecular Weight | 344.34 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | methyl (2S,3S,4S)-3-hydroxy-3-methyl-4-(4-methylphenyl)sulfonyloxy-5-oxooxolane-2-carboxylate |
| SMILES | COC(=O)[C@H]1OC(=O)[C@@H](OS(=O)(=O)c2ccc(C)cc2)[C@@]1(C)O |
| InChI | InChI=1S/C14H16O8S/c1-8-4-6-9(7-5-8)23(18,19)22-11-13(16)21-10(12(15)20-3)14(11,2)17/h4-7,10-11,17H,1-3H3/t10-,11-,14+/m1/s1 |
| InChIKey | BBUPKEYPLZAYKE-GYSYKLTISA-N |
| XLogP | -0.08 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.34 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|