C19H20O9S2 — CID 10917462
[(2R,3R,4R)-3-hydroxy-4-(4-methylphenyl)sulfonyloxy-5-oxooxolan-2-yl]methyl 4-methylbenzenesulfonate (PubChem CID 10917462) has the molecular formula C19H20O9S2 and a molecular weight of 456.49 g/mol. Its IUPAC name is [(2R,3R,4R)-3-hydroxy-4-(4-methylphenyl)sulfonyloxy-5-oxooxolan-2-yl]methyl 4-methylbenzenesulfonate.
| Compound Name | [(2R,3R,4R)-3-hydroxy-4-(4-methylphenyl)sulfonyloxy-5-oxooxolan-2-yl]methyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10917462 |
| Molecular Formula | C19H20O9S2 |
| Molecular Weight | 456.49 g/mol |
| Exact Mass | 456.05 |
| IUPAC Name | [(2R,3R,4R)-3-hydroxy-4-(4-methylphenyl)sulfonyloxy-5-oxooxolan-2-yl]methyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OC[C@H]2OC(=O)[C@H](OS(=O)(=O)c3ccc(C)cc3)[C@@H]2O)cc1 |
| InChI | InChI=1S/C19H20O9S2/c1-12-3-7-14(8-4-12)29(22,23)26-11-16-17(20)18(19(21)27-16)28-30(24,25)15-9-5-13(2)6-10-15/h3-10,16-18,20H,11H2,1-2H3/t16-,17-,18-/m1/s1 |
| InChIKey | IRMQBGYJCRTOLA-KZNAEPCWSA-N |
| XLogP | 1.07 |
| TPSA | 133.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.49 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|