C22H28N2O8 — CID 100927523
(2S)-2-[[(2E,4E,6E,8E,10E)-12-[[(1S,2S)-1-carboxy-2-methylbutyl]amino]-12-oxododeca-2,4,6,8,10-pentaenoyl]amino]butanedioic acid (PubChem CID 100927523) has the molecular formula C22H28N2O8 and a molecular weight of 448.47 g/mol. Its IUPAC name is (2S)-2-[[(2E,4E,6E,8E,10E)-12-[[(1S,2S)-1-carboxy-2-methylbutyl]amino]-12-oxododeca-2,4,6,8,10-pentaenoyl]amino]butanedioic acid.
| Compound Name | (2S)-2-[[(2E,4E,6E,8E,10E)-12-[[(1S,2S)-1-carboxy-2-methylbutyl]amino]-12-oxododeca-2,4,6,8,10-pentaenoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 100927523 |
| Molecular Formula | C22H28N2O8 |
| Molecular Weight | 448.47 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | (2S)-2-[[(2E,4E,6E,8E,10E)-12-[[(1S,2S)-1-carboxy-2-methylbutyl]amino]-12-oxododeca-2,4,6,8,10-pentaenoyl]amino]butanedioic acid |
| SMILES | CC[C@H](C)[C@H](NC(=O)/C=C/C=C/C=C/C=C/C=C/C(=O)N[C@@H](CC(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C22H28N2O8/c1-3-15(2)20(22(31)32)24-18(26)13-11-9-7-5-4-6-8-10-12-17(25)23-16(21(29)30)14-19(27)28/h4-13,15-16,20H,3,14H2,1-2H3,(H,23,25)(H,24,26)(H,27,28)(H,29,30)(H,31,32)/b5-4+,8-6+,9-7+,12-10+,13-11+/t15-,16-,20-/m0/s1 |
| InChIKey | YTWNEOFIUIUJTG-PVVCQKLLSA-N |
| XLogP | 1.43 |
| TPSA | 170.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.47 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|