C24H30N2O8 — CID 100927524
(2S)-2-[[(2E,4E,6E,8E,10E,12E)-14-[[(1S,2S)-1-carboxy-2-methylbutyl]amino]-14-oxotetradeca-2,4,6,8,10,12-hexaenoyl]amino]butanedioic acid (PubChem CID 100927524) has the molecular formula C24H30N2O8 and a molecular weight of 474.51 g/mol. Its IUPAC name is (2S)-2-[[(2E,4E,6E,8E,10E,12E)-14-[[(1S,2S)-1-carboxy-2-methylbutyl]amino]-14-oxotetradeca-2,4,6,8,10,12-hexaenoyl]amino]butanedioic acid.
| Compound Name | (2S)-2-[[(2E,4E,6E,8E,10E,12E)-14-[[(1S,2S)-1-carboxy-2-methylbutyl]amino]-14-oxotetradeca-2,4,6,8,10,12-hexaenoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 100927524 |
| Molecular Formula | C24H30N2O8 |
| Molecular Weight | 474.51 g/mol |
| Exact Mass | 474.20 |
| IUPAC Name | (2S)-2-[[(2E,4E,6E,8E,10E,12E)-14-[[(1S,2S)-1-carboxy-2-methylbutyl]amino]-14-oxotetradeca-2,4,6,8,10,12-hexaenoyl]amino]butanedioic acid |
| SMILES | CC[C@H](C)[C@H](NC(=O)/C=C/C=C/C=C/C=C/C=C/C=C/C(=O)N[C@@H](CC(=O)O)C(=O)O)C(=O)O |
| InChI | InChI=1S/C24H30N2O8/c1-3-17(2)22(24(33)34)26-20(28)15-13-11-9-7-5-4-6-8-10-12-14-19(27)25-18(23(31)32)16-21(29)30/h4-15,17-18,22H,3,16H2,1-2H3,(H,25,27)(H,26,28)(H,29,30)(H,31,32)(H,33,34)/b6-4+,7-5+,10-8+,11-9+,14-12+,15-13+/t17-,18-,22-/m0/s1 |
| InChIKey | UTCVZSMZWWEEHT-JRMCZIJISA-N |
| XLogP | 1.98 |
| TPSA | 170.10 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.51 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|