C20H36O5S2 — CID 10093620
(1R,2S)-1-[(4R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(1,3-dithian-2-yl)hexan-1-ol (PubChem CID 10093620) has the molecular formula C20H36O5S2 and a molecular weight of 420.64 g/mol. Its IUPAC name is (1R,2S)-1-[(4R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(1,3-dithian-2-yl)hexan-1-ol.
| Compound Name | (1R,2S)-1-[(4R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(1,3-dithian-2-yl)hexan-1-ol |
|---|---|
| PubChem CID | 10093620 |
| Molecular Formula | C20H36O5S2 |
| Molecular Weight | 420.64 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | (1R,2S)-1-[(4R,5R)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]-2-(1,3-dithian-2-yl)hexan-1-ol |
| SMILES | CCCC[C@H](C1SCCCS1)[C@@H](O)[C@H]1OC(C)(C)O[C@@H]1[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C20H36O5S2/c1-6-7-9-13(18-26-10-8-11-27-18)15(21)17-16(24-20(4,5)25-17)14-12-22-19(2,3)23-14/h13-18,21H,6-12H2,1-5H3/t13-,14+,15+,16+,17+/m0/s1 |
| InChIKey | DBMBZPMYTZCRHO-MZBWOGCUSA-N |
| XLogP | 4.02 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.64 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |