C10H10OS3 — CID 100937993
5-cyclopenta-2,4-dien-1-ylsulfanylsulfinylsulfanylcyclopenta-1,3-diene (PubChem CID 100937993) has the molecular formula C10H10OS3 and a molecular weight of 242.39 g/mol. Its IUPAC name is 5-cyclopenta-2,4-dien-1-ylsulfanylsulfinylsulfanylcyclopenta-1,3-diene.
| Compound Name | 5-cyclopenta-2,4-dien-1-ylsulfanylsulfinylsulfanylcyclopenta-1,3-diene |
|---|---|
| PubChem CID | 100937993 |
| Molecular Formula | C10H10OS3 |
| Molecular Weight | 242.39 g/mol |
| Exact Mass | 241.99 |
| IUPAC Name | 5-cyclopenta-2,4-dien-1-ylsulfanylsulfinylsulfanylcyclopenta-1,3-diene |
| SMILES | O=S(SC1C=CC=C1)SC1C=CC=C1 |
| InChI | InChI=1S/C10H10OS3/c11-14(12-9-5-1-2-6-9)13-10-7-3-4-8-10/h1-10H |
| InChIKey | YZYHCBBBEBBPHC-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.39 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|