C10H9S2- — CID 11985273
2-(cyclopenta-2,4-dien-1-yldisulfanyl)cyclopenta-1,3-diene (PubChem CID 11985273) has the molecular formula C10H9S2- and a molecular weight of 193.32 g/mol. Its IUPAC name is 2-(cyclopenta-2,4-dien-1-yldisulfanyl)cyclopenta-1,3-diene.
| Compound Name | 2-(cyclopenta-2,4-dien-1-yldisulfanyl)cyclopenta-1,3-diene |
|---|---|
| PubChem CID | 11985273 |
| Molecular Formula | C10H9S2- |
| Molecular Weight | 193.32 g/mol |
| Exact Mass | 193.02 |
| IUPAC Name | 2-(cyclopenta-2,4-dien-1-yldisulfanyl)cyclopenta-1,3-diene |
| SMILES | C1=CC(SSc2cc[cH-]c2)C=C1 |
| InChI | InChI=1S/C10H9S2/c1-2-6-9(5-1)11-12-10-7-3-4-8-10/h1-9H/q-1 |
| InChIKey | SZQJCWAFEOCPLW-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.32 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|