C20H18N2O8 — CID 100944119
[4-(3,4-dimethoxybenzoyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]-(3,4-dimethoxyphenyl)methanone (PubChem CID 100944119) has the molecular formula C20H18N2O8 and a molecular weight of 414.37 g/mol. Its IUPAC name is [4-(3,4-dimethoxybenzoyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]-(3,4-dimethoxyphenyl)methanone.
| Compound Name | [4-(3,4-dimethoxybenzoyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]-(3,4-dimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 100944119 |
| Molecular Formula | C20H18N2O8 |
| Molecular Weight | 414.37 g/mol |
| Exact Mass | 414.11 |
| IUPAC Name | [4-(3,4-dimethoxybenzoyl)-5-oxido-1,2,5-oxadiazol-5-ium-3-yl]-(3,4-dimethoxyphenyl)methanone |
| SMILES | COc1ccc(C(=O)c2no[n+]([O-])c2C(=O)c2ccc(OC)c(OC)c2)cc1OC |
| InChI | InChI=1S/C20H18N2O8/c1-26-13-7-5-11(9-15(13)28-3)19(23)17-18(22(25)30-21-17)20(24)12-6-8-14(27-2)16(10-12)29-4/h5-10H,1-4H3 |
| InChIKey | YSBBGBMDZPHAIV-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 124.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.37 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'} |
|---|