C12H13N3O7S — CID 100957500
(2S,3R,5R)-3-methyl-3-[(Z)-1,2-oxazol-5-ylmethoxyiminomethyl]-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 100957500) has the molecular formula C12H13N3O7S and a molecular weight of 343.32 g/mol. Its IUPAC name is (2S,3R,5R)-3-methyl-3-[(Z)-1,2-oxazol-5-ylmethoxyiminomethyl]-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.
| Compound Name | (2S,3R,5R)-3-methyl-3-[(Z)-1,2-oxazol-5-ylmethoxyiminomethyl]-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 100957500 |
| Molecular Formula | C12H13N3O7S |
| Molecular Weight | 343.32 g/mol |
| Exact Mass | 343.05 |
| IUPAC Name | (2S,3R,5R)-3-methyl-3-[(Z)-1,2-oxazol-5-ylmethoxyiminomethyl]-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | C[C@]1(/C=N\OCc2ccno2)[C@H](C(=O)O)N2C(=O)C[C@H]2S1(=O)=O |
| InChI | InChI=1S/C12H13N3O7S/c1-12(6-14-21-5-7-2-3-13-22-7)10(11(17)18)15-8(16)4-9(15)23(12,19)20/h2-3,6,9-10H,4-5H2,1H3,(H,17,18)/b14-6-/t9-,10+,12+/m1/s1 |
| InChIKey | QVZQZKSALPCMPL-WUPNEGNVSA-N |
| XLogP | -0.62 |
| TPSA | 139.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.32 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|