C13H14N2O7S — CID 10713791
(2S,3S,5R)-3-[(Z)-2-(3-methoxy-1,2-oxazol-5-yl)ethenyl]-3-methyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 10713791) has the molecular formula C13H14N2O7S and a molecular weight of 342.33 g/mol. Its IUPAC name is (2S,3S,5R)-3-[(Z)-2-(3-methoxy-1,2-oxazol-5-yl)ethenyl]-3-methyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.
| Compound Name | (2S,3S,5R)-3-[(Z)-2-(3-methoxy-1,2-oxazol-5-yl)ethenyl]-3-methyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 10713791 |
| Molecular Formula | C13H14N2O7S |
| Molecular Weight | 342.33 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | (2S,3S,5R)-3-[(Z)-2-(3-methoxy-1,2-oxazol-5-yl)ethenyl]-3-methyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | COc1cc(/C=C\[C@@]2(C)[C@H](C(=O)O)N3C(=O)C[C@H]3S2(=O)=O)on1 |
| InChI | InChI=1S/C13H14N2O7S/c1-13(4-3-7-5-8(21-2)14-22-7)11(12(17)18)15-9(16)6-10(15)23(13,19)20/h3-5,10-11H,6H2,1-2H3,(H,17,18)/b4-3-/t10-,11+,13+/m1/s1 |
| InChIKey | VKRBXGVLQJIFQW-RZDPLKRSSA-N |
| XLogP | -0.10 |
| TPSA | 127.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.33 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |