C16H13Cl3N2O8S — CID 158260716
(2S,3R,5R)-3-methyl-4,4,7-trioxo-3-[[2-oxo-2-(2,3,6-trichloro-4,5-dihydroxyphenyl)ethyl]iminomethyl]-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 158260716) has the molecular formula C16H13Cl3N2O8S and a molecular weight of 499.71 g/mol. Its IUPAC name is (2S,3R,5R)-3-methyl-4,4,7-trioxo-3-[[2-oxo-2-(2,3,6-trichloro-4,5-dihydroxyphenyl)ethyl]iminomethyl]-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.
| Compound Name | (2S,3R,5R)-3-methyl-4,4,7-trioxo-3-[[2-oxo-2-(2,3,6-trichloro-4,5-dihydroxyphenyl)ethyl]iminomethyl]-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 158260716 |
| Molecular Formula | C16H13Cl3N2O8S |
| Molecular Weight | 499.71 g/mol |
| Exact Mass | 497.95 |
| IUPAC Name | (2S,3R,5R)-3-methyl-4,4,7-trioxo-3-[[2-oxo-2-(2,3,6-trichloro-4,5-dihydroxyphenyl)ethyl]iminomethyl]-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | C[C@]1(/C=N/CC(=O)c2c(Cl)c(O)c(O)c(Cl)c2Cl)[C@H](C(=O)O)N2C(=O)C[C@H]2S1(=O)=O |
| InChI | InChI=1S/C16H13Cl3N2O8S/c1-16(14(15(26)27)21-6(23)2-7(21)30(16,28)29)4-20-3-5(22)8-9(17)11(19)13(25)12(24)10(8)18/h4,7,14,24-25H,2-3H2,1H3,(H,26,27)/b20-4+/t7-,14+,16+/m1/s1 |
| InChIKey | GHVNALVJFDILEV-GUXZQQJFSA-N |
| XLogP | 1.51 |
| TPSA | 161.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.71 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|