C20H21N3O9S — CID 157420723
(2S,3R,5R)-3-[[2-[(4S,5R)-2-(2,3-dihydroxyphenyl)-5-methyl-4,5-dihydro-1,3-oxazol-4-yl]-2-oxoethyl]iminomethyl]-3-methyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 157420723) has the molecular formula C20H21N3O9S and a molecular weight of 479.47 g/mol. Its IUPAC name is (2S,3R,5R)-3-[[2-[(4S,5R)-2-(2,3-dihydroxyphenyl)-5-methyl-4,5-dihydro-1,3-oxazol-4-yl]-2-oxoethyl]iminomethyl]-3-methyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.
| Compound Name | (2S,3R,5R)-3-[[2-[(4S,5R)-2-(2,3-dihydroxyphenyl)-5-methyl-4,5-dihydro-1,3-oxazol-4-yl]-2-oxoethyl]iminomethyl]-3-methyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 157420723 |
| Molecular Formula | C20H21N3O9S |
| Molecular Weight | 479.47 g/mol |
| Exact Mass | 479.10 |
| IUPAC Name | (2S,3R,5R)-3-[[2-[(4S,5R)-2-(2,3-dihydroxyphenyl)-5-methyl-4,5-dihydro-1,3-oxazol-4-yl]-2-oxoethyl]iminomethyl]-3-methyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | C[C@H]1OC(c2cccc(O)c2O)=N[C@@H]1C(=O)C/N=C/[C@@]1(C)[C@H](C(=O)O)N2C(=O)C[C@H]2S1(=O)=O |
| InChI | InChI=1S/C20H21N3O9S/c1-9-15(22-18(32-9)10-4-3-5-11(24)16(10)27)12(25)7-21-8-20(2)17(19(28)29)23-13(26)6-14(23)33(20,30)31/h3-5,8-9,14-15,17,24,27H,6-7H2,1-2H3,(H,28,29)/b21-8+/t9-,14-,15+,17+,20+/m1/s1 |
| InChIKey | BPJGNGUNNCACKE-GZXDKEPPSA-N |
| XLogP | -0.53 |
| TPSA | 183.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.47 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|