C21H24ClN3O9S — CID 158906589
(2S,3R,5R)-3-[[(3S)-3-[(2-chloro-3,4-dihydroxybenzoyl)amino]-4-methyl-2-oxopentyl]iminomethyl]-3-methyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 158906589) has the molecular formula C21H24ClN3O9S and a molecular weight of 529.96 g/mol. Its IUPAC name is (2S,3R,5R)-3-[[(3S)-3-[(2-chloro-3,4-dihydroxybenzoyl)amino]-4-methyl-2-oxopentyl]iminomethyl]-3-methyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.
| Compound Name | (2S,3R,5R)-3-[[(3S)-3-[(2-chloro-3,4-dihydroxybenzoyl)amino]-4-methyl-2-oxopentyl]iminomethyl]-3-methyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 158906589 |
| Molecular Formula | C21H24ClN3O9S |
| Molecular Weight | 529.96 g/mol |
| Exact Mass | 529.09 |
| IUPAC Name | (2S,3R,5R)-3-[[(3S)-3-[(2-chloro-3,4-dihydroxybenzoyl)amino]-4-methyl-2-oxopentyl]iminomethyl]-3-methyl-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | CC(C)[C@H](NC(=O)c1ccc(O)c(O)c1Cl)C(=O)C/N=C/[C@@]1(C)[C@H](C(=O)O)N2C(=O)C[C@H]2S1(=O)=O |
| InChI | InChI=1S/C21H24ClN3O9S/c1-9(2)16(24-19(30)10-4-5-11(26)17(29)15(10)22)12(27)7-23-8-21(3)18(20(31)32)25-13(28)6-14(25)35(21,33)34/h4-5,8-9,14,16,18,26,29H,6-7H2,1-3H3,(H,24,30)(H,31,32)/b23-8+/t14-,16+,18+,21+/m1/s1 |
| InChIKey | JGCUTIIIKXHOBI-KCUWDIGZSA-N |
| XLogP | 0.34 |
| TPSA | 190.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.96 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|