C18H16N2O6S — CID 57321362
(2S,5R)-3-methyl-3-[2-(1-oxidoquinolin-1-ium-2-yl)ethenyl]-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid (PubChem CID 57321362) has the molecular formula C18H16N2O6S and a molecular weight of 388.40 g/mol. Its IUPAC name is (2S,5R)-3-methyl-3-[2-(1-oxidoquinolin-1-ium-2-yl)ethenyl]-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid.
| Compound Name | (2S,5R)-3-methyl-3-[2-(1-oxidoquinolin-1-ium-2-yl)ethenyl]-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 57321362 |
| Molecular Formula | C18H16N2O6S |
| Molecular Weight | 388.40 g/mol |
| Exact Mass | 388.07 |
| IUPAC Name | (2S,5R)-3-methyl-3-[2-(1-oxidoquinolin-1-ium-2-yl)ethenyl]-4,4,7-trioxo-4λ6-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid |
| SMILES | CC1(C=Cc2ccc3ccccc3[n+]2[O-])[C@H](C(=O)O)N2C(=O)C[C@H]2S1(=O)=O |
| InChI | InChI=1S/C18H16N2O6S/c1-18(16(17(22)23)19-14(21)10-15(19)27(18,25)26)9-8-12-7-6-11-4-2-3-5-13(11)20(12)24/h2-9,15-16H,10H2,1H3,(H,22,23)/t15-,16+,18?/m1/s1 |
| InChIKey | JPSMQIVXDISQKW-LNKXUWQBSA-N |
| XLogP | 0.69 |
| TPSA | 118.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.40 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|