C30H44O13Si — CID 100960536
methyl 3-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-2-[(2R,3R,4S,5S,6R)-3,4,5-triacetyl-3,4,5-trihydroxy-6-(1-hydroxy-2-oxopropyl)oxan-2-yl]oxypropanoate (PubChem CID 100960536) has the molecular formula C30H44O13Si and a molecular weight of 640.76 g/mol. Its IUPAC name is methyl 3-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-2-[(2R,3R,4S,5S,6R)-3,4,5-triacetyl-3,4,5-trihydroxy-6-(1-hydroxy-2-oxopropyl)oxan-2-yl]oxypropanoate.
| Compound Name | methyl 3-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-2-[(2R,3R,4S,5S,6R)-3,4,5-triacetyl-3,4,5-trihydroxy-6-(1-hydroxy-2-oxopropyl)oxan-2-yl]oxypropanoate |
|---|---|
| PubChem CID | 100960536 |
| Molecular Formula | C30H44O13Si |
| Molecular Weight | 640.76 g/mol |
| Exact Mass | 640.26 |
| IUPAC Name | methyl 3-[4-[tert-butyl(dimethyl)silyl]oxyphenyl]-2-[(2R,3R,4S,5S,6R)-3,4,5-triacetyl-3,4,5-trihydroxy-6-(1-hydroxy-2-oxopropyl)oxan-2-yl]oxypropanoate |
| SMILES | COC(=O)C(Cc1ccc(O[Si](C)(C)C(C)(C)C)cc1)O[C@H]1O[C@H](C(O)C(C)=O)[C@@](O)(C(C)=O)[C@@](O)(C(C)=O)[C@]1(O)C(C)=O |
| InChI | InChI=1S/C30H44O13Si/c1-16(31)23(35)24-28(37,17(2)32)30(39,19(4)34)29(38,18(3)33)26(42-24)41-22(25(36)40-8)15-20-11-13-21(14-12-20)43-44(9,10)27(5,6)7/h11-14,22-24,26,35,37-39H,15H2,1-10H3/t22?,23?,24-,26+,28+,29+,30+/m1/s1 |
| InChIKey | UKPYFCRSXQXMRZ-NTKMJXPTSA-N |
| XLogP | 0.81 |
| TPSA | 203.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.76 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|