C21H24N6O6S — CID 100963060
(2S)-2-(benzenesulfonamido)-3-[[2-[(5R)-3-[4-(diaminomethylideneamino)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]acetyl]amino]propanoic acid (PubChem CID 100963060) has the molecular formula C21H24N6O6S and a molecular weight of 488.53 g/mol. Its IUPAC name is (2S)-2-(benzenesulfonamido)-3-[[2-[(5R)-3-[4-(diaminomethylideneamino)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]acetyl]amino]propanoic acid.
| Compound Name | (2S)-2-(benzenesulfonamido)-3-[[2-[(5R)-3-[4-(diaminomethylideneamino)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 100963060 |
| Molecular Formula | C21H24N6O6S |
| Molecular Weight | 488.53 g/mol |
| Exact Mass | 488.15 |
| IUPAC Name | (2S)-2-(benzenesulfonamido)-3-[[2-[(5R)-3-[4-(diaminomethylideneamino)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]acetyl]amino]propanoic acid |
| SMILES | NC(N)=Nc1ccc(C2=NO[C@@H](CC(=O)NC[C@H](NS(=O)(=O)c3ccccc3)C(=O)O)C2)cc1 |
| InChI | InChI=1S/C21H24N6O6S/c22-21(23)25-14-8-6-13(7-9-14)17-10-15(33-26-17)11-19(28)24-12-18(20(29)30)27-34(31,32)16-4-2-1-3-5-16/h1-9,15,18,27H,10-12H2,(H,24,28)(H,29,30)(H4,22,23,25)/t15-,18+/m1/s1 |
| InChIKey | CZGPJYQJCYIBQH-QAPCUYQASA-N |
| XLogP | 0.02 |
| TPSA | 198.56 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.53 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|