C57H64NO13P — CID 100963673
2-cyanoethyl [(2R,3R,4R)-1-hydroxy-2,3,4-tris(phenylmethoxy)pentyl] [(2R,3R,4S,5R,6R)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl phosphate (PubChem CID 100963673) has the molecular formula C57H64NO13P and a molecular weight of 1002.11 g/mol. Its IUPAC name is 2-cyanoethyl [(2R,3R,4R)-1-hydroxy-2,3,4-tris(phenylmethoxy)pentyl] [(2R,3R,4S,5R,6R)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl phosphate.
| Compound Name | 2-cyanoethyl [(2R,3R,4R)-1-hydroxy-2,3,4-tris(phenylmethoxy)pentyl] [(2R,3R,4S,5R,6R)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl phosphate |
|---|---|
| PubChem CID | 100963673 |
| Molecular Formula | C57H64NO13P |
| Molecular Weight | 1002.11 g/mol |
| Exact Mass | 1001.41 |
| IUPAC Name | 2-cyanoethyl [(2R,3R,4R)-1-hydroxy-2,3,4-tris(phenylmethoxy)pentyl] [(2R,3R,4S,5R,6R)-6-methoxy-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl phosphate |
| SMILES | CO[C@@H]1O[C@H](COP(=O)(OCCC#N)OC(O)[C@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H](C)OCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C57H64NO13P/c1-43(62-36-44-22-9-3-10-23-44)51(63-37-45-24-11-4-12-25-45)54(66-40-48-30-17-7-18-31-48)56(59)71-72(60,68-35-21-34-58)69-42-50-52(64-38-46-26-13-5-14-27-46)53(65-39-47-28-15-6-16-29-47)55(57(61-2)70-50)67-41-49-32-19-8-20-33-49/h3-20,22-33,43,50-57,59H,21,35-42H2,1-2H3/t43-,50-,51-,52-,53+,54-,55-,56?,57-,72?/m1/s1 |
| InChIKey | DVMULKSXMDPLPV-DOAXQCKJSA-N |
| XLogP | 10.28 |
| TPSA | 162.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 72 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1002.11 |
| LogP ≤ 5 | 10.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|