C45H51N6O15P3 — CID 10441034
[(1S,2S,3S,4R,5S,6S)-2,4-bis[bis(2-cyanoethoxy)phosphoryloxy]-3,5,6-tris(phenylmethoxy)cyclohexyl] bis(2-cyanoethyl) phosphate (PubChem CID 10441034) has the molecular formula C45H51N6O15P3 and a molecular weight of 1008.85 g/mol. Its IUPAC name is [(1S,2S,3S,4R,5S,6S)-2,4-bis[bis(2-cyanoethoxy)phosphoryloxy]-3,5,6-tris(phenylmethoxy)cyclohexyl] bis(2-cyanoethyl) phosphate.
| Compound Name | [(1S,2S,3S,4R,5S,6S)-2,4-bis[bis(2-cyanoethoxy)phosphoryloxy]-3,5,6-tris(phenylmethoxy)cyclohexyl] bis(2-cyanoethyl) phosphate |
|---|---|
| PubChem CID | 10441034 |
| Molecular Formula | C45H51N6O15P3 |
| Molecular Weight | 1008.85 g/mol |
| Exact Mass | 1008.26 |
| IUPAC Name | [(1S,2S,3S,4R,5S,6S)-2,4-bis[bis(2-cyanoethoxy)phosphoryloxy]-3,5,6-tris(phenylmethoxy)cyclohexyl] bis(2-cyanoethyl) phosphate |
| SMILES | N#CCCOP(=O)(OCCC#N)O[C@@H]1[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H](OP(=O)(OCCC#N)OCCC#N)[C@@H](OP(=O)(OCCC#N)OCCC#N)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C45H51N6O15P3/c46-22-10-28-58-67(52,59-29-11-23-47)64-43-40(55-34-37-16-4-1-5-17-37)41(56-35-38-18-6-2-7-19-38)44(65-68(53,60-30-12-24-48)61-31-13-25-49)45(42(43)57-36-39-20-8-3-9-21-39)66-69(54,62-32-14-26-50)63-33-15-27-51/h1-9,16-21,40-45H,10-15,28-36H2/t40-,41-,42-,43+,44-,45-/m0/s1 |
| InChIKey | SEHISYHZVPFMMM-CPPKSIGKSA-N |
| XLogP | 8.82 |
| TPSA | 304.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 21 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 69 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1008.85 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 21 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|