C27H23BO3 — CID 100980880
(3R,7S)-5-[2-[(1S)-1-methoxyethyl]phenyl]-4,6-dioxa-5-borapentacyclo[11.8.0.02,10.03,7.014,19]henicosa-1(13),2(10),8,11,14,16,18,20-octaene (PubChem CID 100980880) has the molecular formula C27H23BO3 and a molecular weight of 406.29 g/mol. Its IUPAC name is (3R,7S)-5-[2-[(1S)-1-methoxyethyl]phenyl]-4,6-dioxa-5-borapentacyclo[11.8.0.02,10.03,7.014,19]henicosa-1(13),2(10),8,11,14,16,18,20-octaene.
| Compound Name | (3R,7S)-5-[2-[(1S)-1-methoxyethyl]phenyl]-4,6-dioxa-5-borapentacyclo[11.8.0.02,10.03,7.014,19]henicosa-1(13),2(10),8,11,14,16,18,20-octaene |
|---|---|
| PubChem CID | 100980880 |
| Molecular Formula | C27H23BO3 |
| Molecular Weight | 406.29 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | (3R,7S)-5-[2-[(1S)-1-methoxyethyl]phenyl]-4,6-dioxa-5-borapentacyclo[11.8.0.02,10.03,7.014,19]henicosa-1(13),2(10),8,11,14,16,18,20-octaene |
| SMILES | CO[C@@H](C)c1ccccc1B1O[C@H]2C=Cc3ccc4c(ccc5ccccc54)c3[C@H]2O1 |
| InChI | InChI=1S/C27H23BO3/c1-17(29-2)20-8-5-6-10-24(20)28-30-25-16-13-19-12-14-22-21-9-4-3-7-18(21)11-15-23(22)26(19)27(25)31-28/h3-17,25,27H,1-2H3/t17-,25-,27-/m0/s1 |
| InChIKey | MERGUQQBJNGDFM-CCXQXCJASA-N |
| XLogP | 5.58 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.29 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|