C15H16BIO3 — CID 10362462
(3aS,7aS)-4-iodo-2-[2-[(1R)-1-methoxyethyl]phenyl]-3a,7a-dihydro-1,3,2-benzodioxaborole (PubChem CID 10362462) has the molecular formula C15H16BIO3 and a molecular weight of 382.01 g/mol. Its IUPAC name is (3aS,7aS)-4-iodo-2-[2-[(1R)-1-methoxyethyl]phenyl]-3a,7a-dihydro-1,3,2-benzodioxaborole.
| Compound Name | (3aS,7aS)-4-iodo-2-[2-[(1R)-1-methoxyethyl]phenyl]-3a,7a-dihydro-1,3,2-benzodioxaborole |
|---|---|
| PubChem CID | 10362462 |
| Molecular Formula | C15H16BIO3 |
| Molecular Weight | 382.01 g/mol |
| Exact Mass | 382.02 |
| IUPAC Name | (3aS,7aS)-4-iodo-2-[2-[(1R)-1-methoxyethyl]phenyl]-3a,7a-dihydro-1,3,2-benzodioxaborole |
| SMILES | CO[C@H](C)c1ccccc1B1O[C@H]2C=CC=C(I)[C@H]2O1 |
| InChI | InChI=1S/C15H16BIO3/c1-10(18-2)11-6-3-4-7-12(11)16-19-14-9-5-8-13(17)15(14)20-16/h3-10,14-15H,1-2H3/t10-,14+,15-/m1/s1 |
| InChIKey | RPLZCRPFEIKGLN-WKPIXPDZSA-N |
| XLogP | 2.76 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.01 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|