C18H19F9O9S — CID 100985945
[(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfanyl)oxan-2-yl]methyl acetate (PubChem CID 100985945) has the molecular formula C18H19F9O9S and a molecular weight of 582.39 g/mol. Its IUPAC name is [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfanyl)oxan-2-yl]methyl acetate.
| Compound Name | [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfanyl)oxan-2-yl]methyl acetate |
|---|---|
| PubChem CID | 100985945 |
| Molecular Formula | C18H19F9O9S |
| Molecular Weight | 582.39 g/mol |
| Exact Mass | 582.06 |
| IUPAC Name | [(2R,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfanyl)oxan-2-yl]methyl acetate |
| SMILES | CC(=O)OC[C@H]1O[C@@H](SC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@H]1OC(C)=O |
| InChI | InChI=1S/C18H19F9O9S/c1-6(28)32-5-10-11(33-7(2)29)12(34-8(3)30)13(35-9(4)31)14(36-10)37-18(26,27)16(21,22)15(19,20)17(23,24)25/h10-14H,5H2,1-4H3/t10-,11+,12+,13-,14+/m1/s1 |
| InChIKey | VAKNFYCGUJEYIB-HTOAHKCRSA-N |
| XLogP | 3.23 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.39 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|