C8H14O — CID 100991457
1,1,2-trideuteriooct-1-en-3-one (PubChem CID 100991457) has the molecular formula C8H14O and a molecular weight of 129.22 g/mol. Its IUPAC name is 1,1,2-trideuteriooct-1-en-3-one.
| Compound Name | 1,1,2-trideuteriooct-1-en-3-one |
|---|---|
| PubChem CID | 100991457 |
| Molecular Formula | C8H14O |
| Molecular Weight | 129.22 g/mol |
| Exact Mass | 129.12 |
| IUPAC Name | 1,1,2-trideuteriooct-1-en-3-one |
| SMILES | [2H]C([2H])=C([2H])C(=O)CCCCC |
| InChI | InChI=1S/C8H14O/c1-3-5-6-7-8(9)4-2/h4H,2-3,5-7H2,1H3/i2D2,4D |
| InChIKey | KLTVSWGXIAYTHO-OVLJBECYSA-N |
| XLogP | 2.32 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.22 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|