C27H31NO — CID 100991652
(2E,4E,6E,8E,10E,12E)-13-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)-4,9-dimethyltrideca-2,4,6,8,10,12-hexaenal (PubChem CID 100991652) has the molecular formula C27H31NO and a molecular weight of 385.55 g/mol. Its IUPAC name is (2E,4E,6E,8E,10E,12E)-13-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)-4,9-dimethyltrideca-2,4,6,8,10,12-hexaenal.
| Compound Name | (2E,4E,6E,8E,10E,12E)-13-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)-4,9-dimethyltrideca-2,4,6,8,10,12-hexaenal |
|---|---|
| PubChem CID | 100991652 |
| Molecular Formula | C27H31NO |
| Molecular Weight | 385.55 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | (2E,4E,6E,8E,10E,12E)-13-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)-4,9-dimethyltrideca-2,4,6,8,10,12-hexaenal |
| SMILES | CC(/C=C/C=O)=C\C=C\C=C(C)\C=C\C=C\c1cc2c3c(c1)CCCN3CCC2 |
| InChI | InChI=1S/C27H31NO/c1-22(10-3-4-11-23(2)13-9-19-29)12-5-6-14-24-20-25-15-7-17-28-18-8-16-26(21-24)27(25)28/h3-6,9-14,19-21H,7-8,15-18H2,1-2H3/b4-3+,12-5+,13-9+,14-6+,22-10+,23-11+ |
| InChIKey | FDONSVUEESGXDA-NSSVOJCBSA-N |
| XLogP | 6.16 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.55 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|