C29H33N2+ — CID 73177597
7-[5-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)penta-2,4-dienylidene]-1-azoniatricyclo[7.3.1.05,13]trideca-1(13),5,8-triene (PubChem CID 73177597) has the molecular formula C29H33N2+ and a molecular weight of 409.60 g/mol. Its IUPAC name is 7-[5-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)penta-2,4-dienylidene]-1-azoniatricyclo[7.3.1.05,13]trideca-1(13),5,8-triene.
| Compound Name | 7-[5-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)penta-2,4-dienylidene]-1-azoniatricyclo[7.3.1.05,13]trideca-1(13),5,8-triene |
|---|---|
| PubChem CID | 73177597 |
| Molecular Formula | C29H33N2+ |
| Molecular Weight | 409.60 g/mol |
| Exact Mass | 409.26 |
| IUPAC Name | 7-[5-(1-azatricyclo[7.3.1.05,13]trideca-5,7,9(13)-trien-7-yl)penta-2,4-dienylidene]-1-azoniatricyclo[7.3.1.05,13]trideca-1(13),5,8-triene |
| SMILES | C(=CC=c1cc2c3c(c1)CCC[N+]=3CCC2)C=Cc1cc2c3c(c1)CCCN3CCC2 |
| InChI | InChI=1S/C29H33N2/c1(2-8-22-18-24-10-4-14-30-15-5-11-25(19-22)28(24)30)3-9-23-20-26-12-6-16-31-17-7-13-27(21-23)29(26)31/h1-3,8-9,18-21H,4-7,10-17H2/q+1 |
| InChIKey | LUDMNCZHJFEMTB-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.60 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|