C22H38OSi — CID 100993426
[(3aR,4S,7aS)-7a-methyl-1-[(2R)-non-4-yn-2-yl]-3,3a,4,5,6,7-hexahydroinden-4-yl]oxy-trimethylsilane (PubChem CID 100993426) has the molecular formula C22H38OSi and a molecular weight of 346.63 g/mol. Its IUPAC name is [(3aR,4S,7aS)-7a-methyl-1-[(2R)-non-4-yn-2-yl]-3,3a,4,5,6,7-hexahydroinden-4-yl]oxy-trimethylsilane.
| Compound Name | [(3aR,4S,7aS)-7a-methyl-1-[(2R)-non-4-yn-2-yl]-3,3a,4,5,6,7-hexahydroinden-4-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 100993426 |
| Molecular Formula | C22H38OSi |
| Molecular Weight | 346.63 g/mol |
| Exact Mass | 346.27 |
| IUPAC Name | [(3aR,4S,7aS)-7a-methyl-1-[(2R)-non-4-yn-2-yl]-3,3a,4,5,6,7-hexahydroinden-4-yl]oxy-trimethylsilane |
| SMILES | CCCCC#CC[C@@H](C)C1=CC[C@H]2[C@@H](O[Si](C)(C)C)CCC[C@]12C |
| InChI | InChI=1S/C22H38OSi/c1-7-8-9-10-11-13-18(2)19-15-16-20-21(23-24(4,5)6)14-12-17-22(19,20)3/h15,18,20-21H,7-9,12-14,16-17H2,1-6H3/t18-,20+,21+,22-/m1/s1 |
| InChIKey | SHUPFDJOYAAIBQ-RYFAJOAYSA-N |
| XLogP | 6.56 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.63 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|