C15H20BrNO — CID 100993913
(1R,2R,4R)-2-(6-bromo-2-pyridinyl)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol (PubChem CID 100993913) has the molecular formula C15H20BrNO and a molecular weight of 310.24 g/mol. Its IUPAC name is (1R,2R,4R)-2-(6-bromo-2-pyridinyl)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol.
| Compound Name | (1R,2R,4R)-2-(6-bromo-2-pyridinyl)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol |
|---|---|
| PubChem CID | 100993913 |
| Molecular Formula | C15H20BrNO |
| Molecular Weight | 310.24 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | (1R,2R,4R)-2-(6-bromo-2-pyridinyl)-1,7,7-trimethylbicyclo[2.2.1]heptan-2-ol |
| SMILES | CC1(C)[C@@H]2CC[C@@]1(C)[C@@](O)(c1cccc(Br)n1)C2 |
| InChI | InChI=1S/C15H20BrNO/c1-13(2)10-7-8-14(13,3)15(18,9-10)11-5-4-6-12(16)17-11/h4-6,10,18H,7-9H2,1-3H3/t10-,14-,15+/m1/s1 |
| InChIKey | LMJFQRWFXXGKBA-KMUNFCNLSA-N |
| XLogP | 3.88 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.24 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|