C15H25NO3Si — CID 100995807
prop-2-enyl (5S)-2-hydroxy-5-(4-trimethylsilylbut-2-ynyl)pyrrolidine-1-carboxylate (PubChem CID 100995807) has the molecular formula C15H25NO3Si and a molecular weight of 295.46 g/mol. Its IUPAC name is prop-2-enyl (5S)-2-hydroxy-5-(4-trimethylsilylbut-2-ynyl)pyrrolidine-1-carboxylate.
| Compound Name | prop-2-enyl (5S)-2-hydroxy-5-(4-trimethylsilylbut-2-ynyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 100995807 |
| Molecular Formula | C15H25NO3Si |
| Molecular Weight | 295.46 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | prop-2-enyl (5S)-2-hydroxy-5-(4-trimethylsilylbut-2-ynyl)pyrrolidine-1-carboxylate |
| SMILES | C=CCOC(=O)N1C(O)CC[C@H]1CC#CC[Si](C)(C)C |
| InChI | InChI=1S/C15H25NO3Si/c1-5-11-19-15(18)16-13(9-10-14(16)17)8-6-7-12-20(2,3)4/h5,13-14,17H,1,8-12H2,2-4H3/t13-,14?/m1/s1 |
| InChIKey | OUSLAMPYCDEPON-KWCCSABGSA-N |
| XLogP | 2.82 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.46 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|