C33H39NO2 — CID 100997247
1-[7-[(4-decoxyphenyl)methylideneamino]-9H-fluoren-2-yl]propan-1-one (PubChem CID 100997247) has the molecular formula C33H39NO2 and a molecular weight of 481.68 g/mol. Its IUPAC name is 1-[7-[(4-decoxyphenyl)methylideneamino]-9H-fluoren-2-yl]propan-1-one.
| Compound Name | 1-[7-[(4-decoxyphenyl)methylideneamino]-9H-fluoren-2-yl]propan-1-one |
|---|---|
| PubChem CID | 100997247 |
| Molecular Formula | C33H39NO2 |
| Molecular Weight | 481.68 g/mol |
| Exact Mass | 481.30 |
| IUPAC Name | 1-[7-[(4-decoxyphenyl)methylideneamino]-9H-fluoren-2-yl]propan-1-one |
| SMILES | CCCCCCCCCCOc1ccc(/C=N/c2ccc3c(c2)Cc2cc(C(=O)CC)ccc2-3)cc1 |
| InChI | InChI=1S/C33H39NO2/c1-3-5-6-7-8-9-10-11-20-36-30-16-12-25(13-17-30)24-34-29-15-19-32-28(23-29)22-27-21-26(33(35)4-2)14-18-31(27)32/h12-19,21,23-24H,3-11,20,22H2,1-2H3/b34-24+ |
| InChIKey | DRNOHVRLRCYPJZ-JGRMKTMXSA-N |
| XLogP | 9.12 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.68 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|