C30H32F4N2O6 — CID 10099979
2-methyl-2-(4-propan-2-ylphenoxy)-3-[4-[2-[[6-(2,2,3,3-tetrafluoropropoxy)pyridine-3-carbonyl]amino]ethoxy]phenyl]propanoic acid (PubChem CID 10099979) has the molecular formula C30H32F4N2O6 and a molecular weight of 592.59 g/mol. Its IUPAC name is 2-methyl-2-(4-propan-2-ylphenoxy)-3-[4-[2-[[6-(2,2,3,3-tetrafluoropropoxy)pyridine-3-carbonyl]amino]ethoxy]phenyl]propanoic acid.
| Compound Name | 2-methyl-2-(4-propan-2-ylphenoxy)-3-[4-[2-[[6-(2,2,3,3-tetrafluoropropoxy)pyridine-3-carbonyl]amino]ethoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 10099979 |
| Molecular Formula | C30H32F4N2O6 |
| Molecular Weight | 592.59 g/mol |
| Exact Mass | 592.22 |
| IUPAC Name | 2-methyl-2-(4-propan-2-ylphenoxy)-3-[4-[2-[[6-(2,2,3,3-tetrafluoropropoxy)pyridine-3-carbonyl]amino]ethoxy]phenyl]propanoic acid |
| SMILES | CC(C)c1ccc(OC(C)(Cc2ccc(OCCNC(=O)c3ccc(OCC(F)(F)C(F)F)nc3)cc2)C(=O)O)cc1 |
| InChI | InChI=1S/C30H32F4N2O6/c1-19(2)21-6-11-24(12-7-21)42-29(3,28(38)39)16-20-4-9-23(10-5-20)40-15-14-35-26(37)22-8-13-25(36-17-22)41-18-30(33,34)27(31)32/h4-13,17,19,27H,14-16,18H2,1-3H3,(H,35,37)(H,38,39) |
| InChIKey | JWWIXULMRNOXCX-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 106.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.59 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|