C20H18F4N2O4 — CID 86890468
N-[(4-methoxy-3-prop-2-ynoxyphenyl)methyl]-6-(2,2,3,3-tetrafluoropropoxy)pyridine-3-carboxamide (PubChem CID 86890468) has the molecular formula C20H18F4N2O4 and a molecular weight of 426.37 g/mol. Its IUPAC name is N-[(4-methoxy-3-prop-2-ynoxyphenyl)methyl]-6-(2,2,3,3-tetrafluoropropoxy)pyridine-3-carboxamide.
| Compound Name | N-[(4-methoxy-3-prop-2-ynoxyphenyl)methyl]-6-(2,2,3,3-tetrafluoropropoxy)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 86890468 |
| Molecular Formula | C20H18F4N2O4 |
| Molecular Weight | 426.37 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | N-[(4-methoxy-3-prop-2-ynoxyphenyl)methyl]-6-(2,2,3,3-tetrafluoropropoxy)pyridine-3-carboxamide |
| SMILES | C#CCOc1cc(CNC(=O)c2ccc(OCC(F)(F)C(F)F)nc2)ccc1OC |
| InChI | InChI=1S/C20H18F4N2O4/c1-3-8-29-16-9-13(4-6-15(16)28-2)10-26-18(27)14-5-7-17(25-11-14)30-12-20(23,24)19(21)22/h1,4-7,9,11,19H,8,10,12H2,2H3,(H,26,27) |
| InChIKey | NBAMCCSKPQSEIS-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 69.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.37 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|